WolframAlpha computational knowledge AI
InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
COMPUTING...COMPUTING...